id | C00010514 |
---|---|
Name | Picroside II / Vanilloyl catalpol |
CAS RN | 39012-20-9 |
Standard InChI | InChI=1S/C23H28O13/c1-31-12-6-9(2-3-11(12)26)20(30)34-18-10-4-5-32-21(14(10)23(8-25)19(18)36-23)35-22-17(29)16(28)15(27)13(7-24)33-22/h2-6,10,13-19,21-22,24-29H,7-8H2,1H3/t10-,13?,14-,15-,16?,17+,18+,19+,21+,22+,23-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C23H28O13/c1-31-12-6-9(2-3-11(12)26)20(30)34-18-10-4-5-32-21(14(10)23(8-25)19(18)36-23)35-22-17(29)16(28)15(27)13(7-24)33-22/h2-6,10,13-19,21-22,24-29H,7-8H2,1H3 |
Phytochemical cluster | No. 36 |
---|---|
KCF-S cluster | No. 287 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL510404 |
By LinkDB |
---|
By CAS RN | C416837 |
---|
class name | count |
---|---|
asterids | 4 |
family name | count |
---|---|
Plantaginaceae | 4 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Neopicrorhiza scrophulariiflora | 470706 | Plantaginaceae | asterids | Viridiplantae |
Picrorhiza kurroa | 195120 | Plantaginaceae | asterids | Viridiplantae |
Picrorhiza kurrooa | 195120 | Plantaginaceae | asterids | Viridiplantae |
Picrorhiza scrophulariiflora | 470706 | Plantaginaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P07900 | Heat shock protein HSP 90-alpha | Other cytosolic protein | CHEMBL510404 |
CHEMBL2338980
(1)
|
0 / 0 |