| id | C00010569 |
|---|---|
| Name | Harpagide |
| CAS RN | 6926-08-5 |
| Standard InChI | InChI=1S/C15H24O10/c1-14(21)4-7(17)15(22)2-3-23-13(11(14)15)25-12-10(20)9(19)8(18)6(5-16)24-12/h2-3,6-13,16-22H,4-5H2,1H3/t6?,7-,8-,9?,10+,11-,12?,13?,14+,15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H24O10/c1-14(21)4-7(17)15(22)2-3-23-13(11(14)15)25-12-10(20)9(19)8(18)6(5-16)24-12/h2-3,6-13,16-22H,4-5H2,1H3 |
| Phytochemical cluster | No. 36 |
|---|---|
| KCF-S cluster | No. 64 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL430183 |
| By LinkDB |
|---|
| By CAS RN | C033250 |
|---|
| class name | count |
|---|---|
| asterids | 22 |
| family name | count |
|---|---|
| Lamiaceae | 18 |
| Scrophulariaceae | 3 |
| Pedaliaceae | 1 |
| Tenebrionidae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL430183 |
CHEMBL1816430
(1)
|
0 / 3 |