| id | C00001329 |
|---|---|
| Name | gamma-Undecalactone |
| CAS RN | 104-67-6 |
| Standard InChI | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3/t10-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1374 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL195827 |
| By LinkDB | C08571 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Prunus persica | 3760 | Rosaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL195827 |
CHEMBL830921
(1)
|
0 / 0 |