| id | C00013596 |
|---|---|
| Name | Sinensetin / Pedalitin permethyl ether / 5,6,7,3',4'-Pentamethoxyflavone / 2-(3,4-Dimethoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one |
| CAS RN | 2306-27-6 |
| Standard InChI | InChI=1S/C20H20O7/c1-22-13-7-6-11(8-15(13)23-2)14-9-12(21)18-16(27-14)10-17(24-3)19(25-4)20(18)26-5/h6-10H,1-5H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O7/c1-22-13-7-6-11(8-15(13)23-2)14-9-12(21)18-16(27-14)10-17(24-3)19(25-4)20(18)26-5/h6-10H,1-5H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | CHEMBL226507 |
|---|---|
| By standard InChI Main Layer | CHEMBL226507 |
| By LinkDB | C10186 |
|---|
| By CAS RN | C059295 |
|---|
| class name | count |
|---|---|
| asterids | 8 |
| rosids | 4 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Asteraceae | 4 |
| Lamiaceae | 3 |
| Rutaceae | 3 |
| Amaranthaceae | 1 |
| Plantaginaceae | 1 |
| Fabaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04798 | Cytochrome P450 1A1 | Cytochrome P450 1A1 | CHEMBL226507 |
CHEMBL1780385
(1)
|
0 / 0 |
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL226507 |
CHEMBL1687396
(1)
CHEMBL2076249
(1)
|
1 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL226507 |
CHEMBL1738606
(1)
|
0 / 0 |
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL226507 |
CHEMBL1687393
(1)
CHEMBL1687394
(1)
|
2 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL226507 |
CHEMBL1794536
(1)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL226507 |
CHEMBL1614257
(1)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL226507 |
CHEMBL1614257
(1)
|
1 / 3 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C059295 | 1543 |
CYP1A1
AHH AHRR CP11 CYP1 P1-450 P450-C P450DX |
cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | CYP1A1 protein results in increased metabolism of sinensetin |
increases metabolic processing
|
protein |
19666078
|
| C059295 | 1544 |
CYP1A2
CP12 P3-450 P450(PA) |
cytochrome P450, family 1, subfamily A, polypeptide 2 (EC:1.14.14.1) | CYP1A2 protein results in increased metabolism of sinensetin |
increases metabolic processing
|
protein |
19666078
|
| C059295 | 1545 |
CYP1B1
CP1B CYPIB1 GLC3A P4501B1 |
cytochrome P450, family 1, subfamily B, polypeptide 1 (EC:1.14.14.1) | CYP1B1 protein results in increased metabolism of sinensetin |
increases metabolic processing
|
protein |
19666078
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #614490 | Blood group, junior system; jr |
Q9UNQ0
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #612244 | Inflammatory bowel disease 13; ibd13 |
P08183
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #138900 | Uric acid concentration, serum, quantitative trait locus 1; uaqtl1 |
Q9UNQ0
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|