| id | C00001555 |
|---|---|
| Name | Trigonelline |
| CAS RN | 535-83-1 |
| Standard InChI | InChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3 |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 3681 |
| By standard InChI | CHEMBL350675 |
|---|---|
| By standard InChI Main Layer | CHEMBL350675 |
| By LinkDB | C01004 |
|---|
| By CAS RN | C009560 |
|---|
| class name | count |
|---|---|
| rosids | 19 |
| asterids | 3 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Fabaceae | 18 |
| Rubiaceae | 1 |
| Gnetaceae | 1 |
| Styelidae | 1 |
| Apocynaceae | 1 |
| Asteraceae | 1 |
| Cannabaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75604 | Ubiquitin carboxyl-terminal hydrolase 2 | Enzyme | CHEMBL350675 |
CHEMBL1614331
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL350675 |
CHEMBL1794401
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL350675 |
CHEMBL2354311
(1)
|
1 / 0 |