| id | C00001898 |
|---|---|
| Name | Palmatine |
| CAS RN | 3486-67-7 |
| Standard InChI | InChI=1S/C21H22NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-12H,7-8H2,1-4H3/q+1 |
| Standard InChI (Main Layer) | InChI=1S/C21H22NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-12H,7-8H2,1-4H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 155 |
| By standard InChI | CHEMBL206106 |
|---|---|
| By standard InChI Main Layer | CHEMBL206106 |
| By LinkDB | C05315 |
|---|
| By CAS RN | C005413 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 3 |
| family name | count |
|---|---|
| Berberidaceae | 2 |
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Berberis spp. | 22774 | Berberidaceae | eudicotyledons | Viridiplantae |
| Jateorhiza palmata | 461596 | Menispermaceae | eudicotyledons | Viridiplantae |
| Mahonia spp. | 22774 | Berberidaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL206106 |
CHEMBL1614110
(1)
CHEMBL1741321
(1)
|
1 / 0 |
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL206106 |
CHEMBL1614544
(1)
|
11 / 10 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL206106 |
CHEMBL1741325
(1)
|
0 / 1 |
| Q16665 | Hypoxia-inducible factor 1-alpha | Transcription Factor | CHEMBL206106 |
CHEMBL1614456
(1)
CHEMBL1613803
(1)
|
0 / 0 |
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL206106 |
CHEMBL1794467
(1)
|
0 / 0 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL206106 |
CHEMBL1741322
(1)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL206106 |
CHEMBL1741323
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL206106 |
CHEMBL1741324
(1)
|
0 / 1 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C005413 | 332 |
BIRC5
API4 EPR-1 |
baculoviral IAP repeat containing 5 | palmatine binds to BIRC5 promoter |
affects binding
|
promoter |
17968851
|
| C005413 | 6347 |
CCL2
GDCF-2 HC11 HSMCR30 MCAF MCP-1 MCP1 SCYA2 SMC-CF |
chemokine (C-C motif) ligand 2 | palmatine results in decreased expression of CCL2 protein |
decreases expression
|
protein |
20116850
|
| C005413 | 6348 |
CCL3
G0S19-1 LD78ALPHA MIP-1-alpha MIP1A SCYA3 |
chemokine (C-C motif) ligand 3 | palmatine results in decreased expression of CCL3 protein |
decreases expression
|
protein |
20116850
|
| C005413 | 6351 |
CCL4
ACT2 AT744.1 G-26 HC21 LAG-1 LAG1 MIP-1-beta MIP1B MIP1B1 SCYA2 SCYA4 |
chemokine (C-C motif) ligand 4 | palmatine results in decreased expression of CCL4 protein |
decreases expression
|
protein |
20116850
|
| C005413 | 6352 |
CCL5
D17S136E RANTES SCYA5 SIS-delta SISd TCP228 eoCP |
chemokine (C-C motif) ligand 5 | palmatine results in decreased expression of CCL5 protein |
decreases expression
|
protein |
20116850
|
| C005413 | 3570 |
IL6R
CD126 IL-6R-1 IL-6RA IL6Q IL6RA IL6RQ gp80 |
interleukin 6 receptor | palmatine results in decreased expression of IL6R protein modified form |
decreases expression
|
protein |
20116850
|
| C005413 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | palmatine results in decreased expression of IL8 protein |
decreases expression
|
protein |
20116850
|
| C005413 | 7422 |
VEGFA
MVCD1 VEGF VPF |
vascular endothelial growth factor A | palmatine results in decreased expression of VEGFA protein |
decreases expression
|
protein |
20116850
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a |
P02545
|
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism |
P02545
|
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 |
P02545
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 |
P02545
|
| #610140 | Heart-hand syndrome, slovenian type |
P02545
|
| #176670 | Hutchinson-gilford progeria syndrome; hgps |
P02545
|
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 |
P02545
|
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada |
P02545
|
| #613205 | Muscular dystrophy, congenital, lmna-related |
P02545
|
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b |
P02545
|
| #275210 | Restrictive dermopathy, lethal |
P02545
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00264 | Charcot-Marie-Tooth disease (CMT) |
P02545
(related)
|
| H00294 | Dilated cardiomyopathy (DCM) |
P02545
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P02545
(related)
|
| H00563 | Emery-Dreifuss muscular dystrophy |
P02545
(related)
|
| H00590 | Congenital muscular dystrophies (CMD/MDC) |
P02545
(related)
|
| H00593 | Limb-girdle muscular dystrophy (LGMD) |
P02545
(related)
|
| H00601 | Hutchinson-Gilford progeria syndrome |
P02545
(related)
|
| H00663 | Restrictive dermopathy |
P02545
(related)
|
| H00665 | Mandibuloacral dysplasia |
P02545
(related)
|
| H01216 | Left ventricular noncompaction (LVNC) |
P02545
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|