id | C00025231 |
---|---|
Name | Asimilobine / (-)-Asimilobine |
CAS RN | 6871-21-2 |
Standard InChI | InChI=1S/C17H17NO2/c1-20-17-14(19)9-11-6-7-18-13-8-10-4-2-3-5-12(10)16(17)15(11)13/h2-5,9,13,18-19H,6-8H2,1H3/t13-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C17H17NO2/c1-20-17-14(19)9-11-6-7-18-13-8-10-4-2-3-5-12(10)16(17)15(11)13/h2-5,9,13,18-19H,6-8H2,1H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 20 |
By standard InChI | CHEMBL469423 |
---|---|
By standard InChI Main Layer | CHEMBL389271 CHEMBL469423 |
By LinkDB |
---|
By CAS RN | C054614 |
---|
class name | count |
---|---|
Magnoliophyta | 18 |
eudicotyledons | 4 |
family name | count |
---|---|
Annonaceae | 15 |
Menispermaceae | 4 |
Siparunaceae | 2 |
Magnoliaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P22303 | Acetylcholinesterase | Hydrolase | CHEMBL469423 |
CHEMBL975663
(1)
|
1 / 0 |