id | C00027481 |
---|---|
Name | Salsoline / (-)-O7-Methylsalsolinol |
CAS RN | 89-31-6 |
Standard InChI | InChI=1S/C11H15NO2/c1-7-9-6-11(14-2)10(13)5-8(9)3-4-12-7/h5-7,12-13H,3-4H2,1-2H3/t7-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C11H15NO2/c1-7-9-6-11(14-2)10(13)5-8(9)3-4-12-7/h5-7,12-13H,3-4H2,1-2H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 2962 |
By standard InChI | CHEMBL1187592 |
---|---|
By standard InChI Main Layer | CHEMBL1187592 CHEMBL1192723 CHEMBL1532461 |
By LinkDB | C09640 |
---|
By CAS RN | C032837 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Alangium lamarckii | 16896 | Cornaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1187592 |
CHEMBL1614110
(1)
|
1 / 0 |
P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1532461 |
CHEMBL1614458
(1)
|
0 / 0 |
Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL1187592 |
CHEMBL1614227
(1)
|
3 / 3 |