id | C00028751 |
---|---|
Name | O,O-Dimethylcorytuberine |
CAS RN | 6191-46-4 |
Standard InChI | InChI=1S/C21H25NO4/c1-22-9-8-13-11-16(24-3)21(26-5)19-17(13)14(22)10-12-6-7-15(23-2)20(25-4)18(12)19/h6-7,11,14H,8-10H2,1-5H3/t14-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C21H25NO4/c1-22-9-8-13-11-16(24-3)21(26-5)19-17(13)14(22)10-12-6-7-15(23-2)20(25-4)18(12)19/h6-7,11,14H,8-10H2,1-5H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 20 |
By standard InChI | CHEMBL486381 |
---|---|
By standard InChI Main Layer | CHEMBL206505 CHEMBL486381 |
By LinkDB |
---|
By CAS RN | C013897 |
---|
class name | count |
---|---|
Magnoliophyta | 1 |
family name | count |
---|---|
Lauraceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Ocotea holdrigeiana | 63801 | Lauraceae | Magnoliophyta | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P22303 | Acetylcholinesterase | Hydrolase | CHEMBL206505 |
CHEMBL866857
(1)
CHEMBL866858
(1)
|
1 / 0 |