id | C00003070 |
---|---|
Name | Amarogentin |
CAS RN | 21018-84-8 |
Standard InChI | InChI=1S/C29H30O13/c1-2-16-17-6-7-38-26(36)19(17)12-39-28(16)42-29-25(24(35)23(34)21(11-30)40-29)41-27(37)22-18(9-15(32)10-20(22)33)13-4-3-5-14(31)8-13/h2-5,8-10,12,16-17,21,23-25,28-35H,1,6-7,11H2/t16-,17+,21?,23-,24+,25?,28+,29+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C29H30O13/c1-2-16-17-6-7-38-26(36)19(17)12-39-28(16)42-29-25(24(35)23(34)21(11-30)40-29)41-27(37)22-18(9-15(32)10-20(22)33)13-4-3-5-14(31)8-13/h2-5,8-10,12,16-17,21,23-25,28-35H,1,6-7,11H2 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 2478 |
By standard InChI | |
---|---|
By standard InChI Main Layer |
By LinkDB | C09767 |
---|
By CAS RN | C102609 |
---|
class name | count |
---|---|
asterids | 4 |
family name | count |
---|---|
Gentianaceae | 4 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Gentiana lutea | 38851 | Gentianaceae | asterids | Viridiplantae |
Gentiana sp. | 21496 | Gentianaceae | asterids | Viridiplantae |
Swertia japonica | 137129 | Gentianaceae | asterids | Viridiplantae |
Swertia spp. | 39241 | Gentianaceae | asterids | Viridiplantae |
compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
---|---|---|---|---|---|---|---|
C102609 | 259296 |
TAS2R50
T2R50 T2R51 TAS2R51 |
taste receptor, type 2, member 50 | amarogentin binds to and results in increased activity of TAS2R50 protein |
affects binding
/ increases activity |
protein |
19817411
|