id | C00003082 |
---|---|
Name | Gentiopicrin / Gentiopicroside |
CAS RN | 20831-76-9 |
Standard InChI | InChI=1S/C16H20O9/c1-2-7-8-3-4-22-14(21)9(8)6-23-15(7)25-16-13(20)12(19)11(18)10(5-17)24-16/h2-3,6-7,10-13,15-20H,1,4-5H2/t7-,10?,11-,12+,13?,15+,16+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C16H20O9/c1-2-7-8-3-4-22-14(21)9(8)6-23-15(7)25-16-13(20)12(19)11(18)10(5-17)24-16/h2-3,6-7,10-13,15-20H,1,4-5H2 |
Phytochemical cluster | No. 36 |
---|---|
KCF-S cluster | No. 3781 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL508320 |
By LinkDB | C09782 |
---|
By CAS RN | C012997 |
---|
class name | count |
---|---|
asterids | 5 |
family name | count |
---|---|
Gentianaceae | 5 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Gentiana lutea | 38851 | Gentianaceae | asterids | Viridiplantae |
Gentiana manshurica | 683755 | Gentianaceae | asterids | Viridiplantae |
Gentiana rigescens | 553056 | Gentianaceae | asterids | Viridiplantae |
Gentiana scabra | 292393 | Gentianaceae | asterids | Viridiplantae |
Radix gentianae | ||||
Swertia franchetiana | 50785 | Gentianaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL508320 |
CHEMBL1794584
(1)
|
2 / 0 |
P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL508320 |
CHEMBL1794401
(1)
|
0 / 0 |
OMIM | preferred title | UniProt |
---|---|---|
#114500 | Colorectal cancer; crc |
P84022
|
#613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|