id | C00003245 |
---|---|
Name | Dehydrocostus lactone |
CAS RN | 477-43-0 |
Standard InChI | InChI=1S/C15H18O2/c1-8-4-7-12-10(3)15(16)17-14(12)13-9(2)5-6-11(8)13/h11-14H,1-7H2/t11-,12-,13-,14-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C15H18O2/c1-8-4-7-12-10(3)15(16)17-14(12)13-9(2)5-6-11(8)13/h11-14H,1-7H2 |
Phytochemical cluster | No. 38 |
---|---|
KCF-S cluster | No. 306 |
By standard InChI | CHEMBL88985 |
---|---|
By standard InChI Main Layer | CHEMBL88985 CHEMBL487201 CHEMBL1939730 |
By LinkDB | C09387 |
---|
By CAS RN | C083030 |
---|
class name | count |
---|---|
asterids | 5 |
Magnoliophyta | 1 |
Embryophyta | 1 |
family name | count |
---|---|
Asteraceae | 5 |
Lauraceae | 1 |
Targioniaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P03372 | Estrogen receptor | NR3A1 | CHEMBL1939730 |
CHEMBL1941568
(1)
CHEMBL1941569
(1)
|
1 / 1 |