| id | C00033258 |
|---|---|
| Name | Nucenide / Nuezhenide |
| CAS RN | 39011-92-2 |
| Standard InChI | InChI=1S/C31H42O17/c1-3-16-17(18(28(41)42-2)12-45-29(16)48-31-27(40)24(37)22(35)19(11-32)46-31)10-21(34)44-13-20-23(36)25(38)26(39)30(47-20)43-9-8-14-4-6-15(33)7-5-14/h3-7,12,17,19-20,22-27,29-33,35-40H,8-11,13H2,1-2H3/b16-3+/t17-,19+,20?,22+,23+,24-,25-,26+,27+,29-,30+,31-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C31H42O17/c1-3-16-17(18(28(41)42-2)12-45-29(16)48-31-27(40)24(37)22(35)19(11-32)46-31)10-21(34)44-13-20-23(36)25(38)26(39)30(47-20)43-9-8-14-4-6-15(33)7-5-14/h3-7,12,17,19-20,22-27,29-33,35-40H,8-11,13H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 545 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1076818 |
| By LinkDB |
|---|
| By CAS RN | C083178 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Fraxinus americana | 38872 | Oleaceae | asterids | Viridiplantae |
| Fraxinus excelsior L. | 38873 | Oleaceae | asterids | Viridiplantae |
| Ligustrum lucidum | 458695 | Oleaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14672 | Solute carrier family 2, facilitated glucose transporter member 4 | Unclassified protein | CHEMBL1076818 |
CHEMBL1103148
(1)
|
1 / 0 |
| Q07869 | Peroxisome proliferator-activated receptor alpha | NR1C1 | CHEMBL1076818 |
CHEMBL1103143
(1)
|
0 / 0 |