| id | C00035564 |
|---|---|
| Name | Citronellyl acetate |
| CAS RN | 150-84-5 |
| Standard InChI | InChI=1S/C12H22O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,11H,5,7-9H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C12H22O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,11H,5,7-9H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4340 |
| By standard InChI | CHEMBL1453648 |
|---|---|
| By standard InChI Main Layer | CHEMBL1453648 |
| By LinkDB | C12298 |
|---|
| By CAS RN | C040879 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Leptospermum scoparium | 295139 | Myrtaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL1453648 |
CHEMBL1614240
(1)
|
0 / 0 |