| id | C00000810 |
|---|---|
| Name | (-)-Menthol |
| CAS RN | 2216-51-5 |
| Standard InChI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3 |
| Phytochemical cluster | No. 35 |
|---|---|
| KCF-S cluster | No. 901 |
| By standard InChI | CHEMBL470670 |
|---|---|
| By standard InChI Main Layer | CHEMBL41763 CHEMBL256087 CHEMBL470670 CHEMBL1907990 CHEMBL1907991 CHEMBL2106989 |
| By LinkDB | C00400 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 4 |
| family name | count |
|---|---|
| Lamiaceae | 3 |
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artemisia spp. | 4219 | Asteraceae | asterids | Viridiplantae |
| Glechoma hederacea | 28509 | Lamiaceae | asterids | Viridiplantae |
| Mentha piperita | 34256 | Lamiaceae | asterids | Viridiplantae |
| Mentha x piperita L. | 34256 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22310 | UDP-glucuronosyltransferase 1-4 | Enzyme | CHEMBL41763 CHEMBL470670 CHEMBL1907990 CHEMBL1907991 |
CHEMBL816283
(1)
CHEMBL1908081
(1)
CHEMBL1908082 (4) |
3 / 0 |
| Q7Z2W7 | Transient receptor potential cation channel subfamily M member 8 | Unclassified protein | CHEMBL256087 |
CHEMBL1224916
(1)
CHEMBL1243606
(1)
CHEMBL1243614 (1) CHEMBL1243615 (1) CHEMBL1243622 (1) |
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL470670 |
CHEMBL1014033
(1)
CHEMBL1008561
(1)
|
0 / 3 |
| P16662 | UDP-glucuronosyltransferase 2B7 | Enzyme | CHEMBL41763 CHEMBL470670 |
CHEMBL1908093
(2)
CHEMBL1908094
(2)
CHEMBL1908095 (2) |
0 / 0 |
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL256087 |
CHEMBL1794311
(1)
|
2 / 3 |
| O60656 | UDP-glucuronosyltransferase 1-9 | Enzyme | CHEMBL470670 CHEMBL1907990 CHEMBL1907991 |
CHEMBL1908086
(3)
|
0 / 0 |
| P54855 | UDP-glucuronosyltransferase 2B15 | Enzyme | CHEMBL470670 |
CHEMBL1908090
(1)
|
0 / 0 |
| Q96RI1 | Bile acid receptor | NR1H4 | CHEMBL256087 |
CHEMBL1794415
(1)
|
0 / 0 |
| O75762 | Transient receptor potential cation channel subfamily A member 1 | Unclassified protein | CHEMBL256087 CHEMBL470670 |
CHEMBL1118242
(1)
CHEMBL1629242
(1)
|
1 / 0 |
| Q9HAW9 | UDP-glucuronosyltransferase 1-8 | Enzyme | CHEMBL470670 |
CHEMBL1908085
(1)
|
0 / 0 |
| Q9Y4X1 | UDP-glucuronosyltransferase 2A1 | Enzyme | CHEMBL41763 CHEMBL470670 CHEMBL1907990 |
CHEMBL1908088
(3)
|
0 / 0 |
| P22309 | UDP-glucuronosyltransferase 1-1 | Enzyme | CHEMBL470670 CHEMBL1907990 |
CHEMBL1908080
(3)
|
5 / 1 |
| P19224 | UDP-glucuronosyltransferase 1-6 | Enzyme | CHEMBL470670 CHEMBL1907990 CHEMBL1907991 |
CHEMBL1908083
(4)
|
0 / 0 |
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL256087 |
CHEMBL1613933
(1)
|
0 / 1 |
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL256087 |
CHEMBL1613933
(1)
|
1 / 6 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #601816 | Bilirubin, serum level of, quantitative trait locus 1; biliqtl1 |
P22309
|
| #218800 | Crigler-najjar syndrome, type i |
P22309
P22310 |
| #606785 | Crigler-najjar syndrome, type ii |
P22309
P22310 |
| #615040 | Episodic pain syndrome, familial, 1; feps1 |
O75762
|
| #143500 | Gilbert syndrome |
P22309
P22310 |
| #237900 | Hyperbilirubinemia, transient familial neonatal; hblrtfn |
P22309
|
| #607948 | Mycobacterium tuberculosis, susceptibility to |
P11473
|
| #601399 | Platelet disorder, familial, with associated myeloid malignancy |
Q01196
|
| #277440 | Vitamin d-dependent rickets, type 2a; vddr2a |
P11473
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00342 | Tuberculosis |
P11473
(related)
|
| H00784 | Localized autosomal recessive hypotrichosis |
P11473
(related)
|
| H01143 | Vitamin D-dependent rickets |
P11473
(related)
|
| H00208 | Hyperbilirubinemia |
P22309
(related)
|
| H00017 | Esophageal cancer |
P35354
(related)
|
| H00025 | Penile cancer |
P35354
(related)
|
| H00046 | Cholangiocarcinoma |
P35354
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q01196
(related)
Q01196 (marker) |
| H00003 | Acute myeloid leukemia (AML) |
Q01196
(related)
Q01196 (marker) Q13951 (marker) |
| H00004 | Chronic myeloid leukemia (CML) |
Q01196
(related)
|
| H00978 | Thrombocytopenia (THC) |
Q01196
(related)
|