id | C00010280 |
---|---|
Name | 3-Methyl-2-butenoic acid |
CAS RN | 541-47-9 |
Standard InChI | InChI=1S/C5H8O2/c1-4(2)3-5(6)7/h3H,1-2H3,(H,6,7) |
Standard InChI (Main Layer) | InChI=1S/C5H8O2/c1-4(2)3-5(6)7/h3H,1-2H3,(H,6,7) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 8322 |
By standard InChI | CHEMBL115725 |
---|---|
By standard InChI Main Layer | CHEMBL115725 |
By LinkDB |
---|
By CAS RN | C011546 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Peucedanum japonicum | 49563 | Apiaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q8TDS4 | Hydroxycarboxylic acid receptor 2 | Hydroxycarboxylic acid receptor | CHEMBL115725 |
CHEMBL1772554
(1)
|
0 / 0 |