| id | C00010280 |
|---|---|
| Name | 3-Methyl-2-butenoic acid |
| CAS RN | 541-47-9 |
| Standard InChI | InChI=1S/C5H8O2/c1-4(2)3-5(6)7/h3H,1-2H3,(H,6,7) |
| Standard InChI (Main Layer) | InChI=1S/C5H8O2/c1-4(2)3-5(6)7/h3H,1-2H3,(H,6,7) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8322 |
| By standard InChI | CHEMBL115725 |
|---|---|
| By standard InChI Main Layer | CHEMBL115725 |
| By LinkDB |
|---|
| By CAS RN | C011546 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Peucedanum japonicum | 49563 | Apiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q8TDS4 | Hydroxycarboxylic acid receptor 2 | Hydroxycarboxylic acid receptor | CHEMBL115725 |
CHEMBL1772554
(1)
|
0 / 0 |