| id | C00010903 |
|---|---|
| Name | (+)-Menthone |
| CAS RN | 3391-87-5 |
| Standard InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3 |
| Phytochemical cluster | No. 35 |
|---|---|
| KCF-S cluster | No. 1288 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL276311 CHEMBL1719455 |
| By LinkDB | C11390 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Barosma pulchellum | 23513 | Rutaceae | rosids | Viridiplantae |
| Mentha gattefosse | 21819 | Lamiaceae | asterids | Viridiplantae |
| Mentha sachalinensis | 294733 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1719455 |
CHEMBL1738606
(1)
|
0 / 0 |