| id | C00010928 |
|---|---|
| Name | Origanol / (S)-(+)-p-Menth-1-en-4-ol |
| CAS RN | 2438-10-0 |
| Standard InChI | InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3/t10-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2215 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL507795 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Cupressaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cupressus macrocarpa | 76352 | Cupressaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22310 | UDP-glucuronosyltransferase 1-4 | Enzyme | CHEMBL507795 |
CHEMBL1908082
(1)
|
3 / 0 |