id | C00000111 |
---|---|
Name | Indole-3-acrylic acid |
CAS RN | 1204-06-4 |
Standard InChI | InChI=1S/C11H9NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-7,12H,(H,13,14)/b6-5- |
Standard InChI (Main Layer) | InChI=1S/C11H9NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-7,12H,(H,13,14) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 7822 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL445966 |
By LinkDB |
---|
By CAS RN | C001446 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Lens culinaris | 3864 | Fabaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q16773 | Kynurenine--oxoglutarate transaminase 1 | Enzyme | CHEMBL445966 |
CHEMBL1002982
(1)
|
0 / 0 |