| id | C00011178 |
|---|---|
| Name | Myricetin 3,4'-di-O-alpha-L-rhamnopyranoside / 3-[(6-Deoxy-alpha-L-mannopyranosyl)oxy]-2-[4-[(6-deoxy-alpha-L-mannopyranosyl)oxy]-3,5-dihydroxyphenyl]-5,7-dihydroxy-4H-1-benzopyran-4-one |
| CAS RN | 200353-68-0 |
| Standard InChI | InChI=1S/C27H30O16/c1-7-16(32)19(35)21(37)26(39-7)42-24-12(30)3-9(4-13(24)31)23-25(43-27-22(38)20(36)17(33)8(2)40-27)18(34)15-11(29)5-10(28)6-14(15)41-23/h3-8,16-17,19-22,26-33,35-38H,1-2H3/t7?,8?,16-,17-,19+,20?,21?,22-,26-,27-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H30O16/c1-7-16(32)19(35)21(37)26(39-7)42-24-12(30)3-9(4-13(24)31)23-25(43-27-22(38)20(36)17(33)8(2)40-27)18(34)15-11(29)5-10(28)6-14(15)41-23/h3-8,16-17,19-22,26-33,35-38H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| family name | count |
|---|---|
| Chrysobalanaceae | 1 |
| Primulaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Licania heteromorpha | 123495 | Chrysobalanaceae | rosids | Viridiplantae |
| Myrsine seguinii | 276780 | Primulaceae | asterids | Viridiplantae |