id | C00001157 |
---|---|
Name | L- Bornesitol |
CAS RN | 22350-68-1 |
Standard InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4?,5?,6?,7-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 795 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL171890 CHEMBL501109 CHEMBL493737 CHEMBL460057 |
By LinkDB |
---|
By CAS RN |
---|
class name | count |
---|---|
rosids | 2 |
asterids | 2 |
eudicotyledons | 1 |
family name | count |
---|---|
Rhamnaceae | 1 |
Apocynaceae | 1 |
Proteaceae | 1 |
Fabaceae | 1 |
Boraginaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Apocynum spp. | 13338 | Apocynaceae | asterids | Viridiplantae |
Banksia integrifolia | 199772 | Proteaceae | eudicotyledons | Viridiplantae |
Lathyrus spp. | 3853 | Fabaceae | rosids | Viridiplantae |
Lithospermum ruderale | 650313 | Boraginaceae | asterids | Viridiplantae |
Rhamnus spp. | 3609 | Rhamnaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O75496 | Geminin | Unclassified protein | CHEMBL171890 |
CHEMBL2114843
(1)
|
0 / 0 |
Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL171890 |
CHEMBL1794569
(1)
|
1 / 1 |