| id | C00001168 |
|---|---|
| Name | Pinitol / D-Pinitol |
| CAS RN | 10284-63-6 |
| Standard InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2?,3-,4?,5?,6+,7-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 795 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL171890 CHEMBL501109 CHEMBL493737 CHEMBL460057 |
| By LinkDB | C03844 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| Spermatophyta | 2 |
| Liliopsida | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Fabaceae | 2 |
| Taxaceae | 1 |
| Pinaceae | 1 |
| Zingiberaceae | 1 |
| Nyctaginaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL171890 |
CHEMBL2114843
(1)
|
0 / 0 |
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL171890 |
CHEMBL1794569
(1)
|
1 / 1 |