| id | C00001168 | 
|---|---|
| Name | Pinitol / D-Pinitol | 
| CAS RN | 10284-63-6 | 
| Standard InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2?,3-,4?,5?,6+,7-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 795 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL171890 CHEMBL501109 CHEMBL493737 CHEMBL460057 | 
| By LinkDB | C03844 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| rosids | 2 | 
| Spermatophyta | 2 | 
| Liliopsida | 1 | 
| eudicotyledons | 1 | 
| family name | count | 
|---|---|
| Fabaceae | 2 | 
| Taxaceae | 1 | 
| Pinaceae | 1 | 
| Zingiberaceae | 1 | 
| Nyctaginaceae | 1 | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL171890 | CHEMBL2114843
                        (1) | 0 / 0 | 
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL171890 | CHEMBL1794569
                        (1) | 1 / 1 |