id | C00001171 |
---|---|
Name | Ribitol |
CAS RN | 488-81-3 |
Standard InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- |
Standard InChI (Main Layer) | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 630 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL96783 CHEMBL1369426 CHEMBL1865120 |
By LinkDB | C00474 |
---|
By CAS RN | D012255 |
---|
class name | count |
---|---|
eudicotyledons | 1 |
asterids | 1 |
rosids | 1 |
family name | count |
---|---|
Ranunculaceae | 1 |
Apiaceae | 1 |
Myrtaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Adonis vernalis | 46985 | Ranunculaceae | eudicotyledons | Viridiplantae |
Bupleurum falcatum | 46367 | Apiaceae | asterids | Viridiplantae |
Eugenia lehmannii | 119950 | Myrtaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1369426 CHEMBL1865120 |
CHEMBL1794536
(2)
|
0 / 0 |