| id | C00001171 |
|---|---|
| Name | Ribitol |
| CAS RN | 488-81-3 |
| Standard InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- |
| Standard InChI (Main Layer) | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 630 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL96783 CHEMBL1369426 CHEMBL1865120 |
| By LinkDB | C00474 |
|---|
| By CAS RN | D012255 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| asterids | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Ranunculaceae | 1 |
| Apiaceae | 1 |
| Myrtaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Adonis vernalis | 46985 | Ranunculaceae | eudicotyledons | Viridiplantae |
| Bupleurum falcatum | 46367 | Apiaceae | asterids | Viridiplantae |
| Eugenia lehmannii | 119950 | Myrtaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1369426 CHEMBL1865120 |
CHEMBL1794536
(2)
|
0 / 0 |