| id | C00011806 | 
|---|---|
| Name | 9-(2R,3R,Epoxy-2-methylbutanoyl)-8alpha,9beta-dihydroxy-1(10)E,4E,11(13)-germacratrien-12,6beta-olide | 
| CAS RN | 72638-72-3 | 
| Standard InChI | InChI=1S/C20H26O6/c1-10-7-6-8-11(2)17(25-19(23)20(5)13(4)26-20)16(21)15-12(3)18(22)24-14(15)9-10/h8-9,13-17,21H,3,6-7H2,1-2,4-5H3/b10-9+,11-8+/t13-,14+,15+,16-,17-,20-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C20H26O6/c1-10-7-6-8-11(2)17(25-19(23)20(5)13(4)26-20)16(21)15-12(3)18(22)24-14(15)9-10/h8-9,13-17,21H,3,6-7H2,1-2,4-5H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1172 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL381063 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Asteraceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Montanoa hibiscifolia | 166991 | Asteraceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL381063 | CHEMBL861583
                        (1) | 0 / 0 |