| id | C00012088 | 
|---|---|
| Name | Isocentratherin | 
| CAS RN | 80377-52-2 | 
| Standard InChI | InChI=1S/C20H22O7/c1-6-9(2)18(23)25-13-8-20(5)14(21)7-12(27-20)10(3)16(22)17-15(13)11(4)19(24)26-17/h6-7,13,15-17,22H,3-4,8H2,1-2,5H3/b9-6-/t13-,15+,16+,17-,20+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C20H22O7/c1-6-9(2)18(23)25-13-8-20(5)14(21)7-12(27-20)10(3)16(22)17-15(13)11(4)19(24)26-17/h6-7,13,15-17,22H,3-4,8H2,1-2,5H3 | 
| Phytochemical cluster | No. 38 | 
|---|---|
| KCF-S cluster | No. 366 | 
| By standard InChI | CHEMBL2205110 | 
|---|---|
| By standard InChI Main Layer | CHEMBL206238 CHEMBL2205110 CHEMBL2205112 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Asteraceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Centratherum punctatum | 434637 | Asteraceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL206238 | CHEMBL861583
                        (1) | 0 / 0 |