| id | C00012119 | 
|---|---|
| Name | 15-Deoxybudlein A / Atripliciolide angelate | 
| CAS RN | 78685-07-1 | 
| Standard InChI | InChI=1S/C20H22O6/c1-6-10(2)18(22)25-15-9-20(5)16(21)8-13(26-20)11(3)7-14-17(15)12(4)19(23)24-14/h6-8,14-15,17H,4,9H2,1-3,5H3/b10-6-,11-7-/t14-,15-,17+,20-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C20H22O6/c1-6-10(2)18(22)25-15-9-20(5)16(21)8-13(26-20)11(3)7-14-17(15)12(4)19(23)24-14/h6-8,14-15,17H,4,9H2,1-3,5H3 | 
| Phytochemical cluster | No. 38 | 
|---|---|
| KCF-S cluster | No. 366 | 
| By standard InChI | CHEMBL371161 | 
|---|---|
| By standard InChI Main Layer | CHEMBL190485 CHEMBL371161 CHEMBL1973811 CHEMBL1987954 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Asteraceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Calea lantanoides | 183008 | Asteraceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL190485 CHEMBL371161 | CHEMBL828644
                        (2)
                        CHEMBL835063
                        (2) CHEMBL861583 (2) | 0 / 0 | 
| Q00653 | Nuclear factor NF-kappa-B p100 subunit | Transcription Factor | CHEMBL190485 CHEMBL371161 | CHEMBL828644
                        (2)
                        CHEMBL835063
                        (2) | 0 / 0 | 
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL190485 CHEMBL371161 | CHEMBL828644
                        (2)
                        CHEMBL835063
                        (2) | 0 / 0 |