| id | C00012198 |
|---|---|
| Name | Herbolide A |
| CAS RN | 64562-23-8 |
| Standard InChI | InChI=1S/C17H24O4/c1-10-6-5-7-11(2)15(20-13(4)18)9-14-12(3)17(19)21-16(14)8-10/h7-8,12,14-16H,5-6,9H2,1-4H3/b10-8-,11-7-/t12-,14-,15+,16+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H24O4/c1-10-6-5-7-11(2)15(20-13(4)18)9-14-12(3)17(19)21-16(14)8-10/h7-8,12,14-16H,5-6,9H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1725 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Asteraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artemisia herba alba | 4219 | Asteraceae | asterids | Viridiplantae |
| Artemisia herba-alba | 72329 | Asteraceae | asterids | Viridiplantae |