| id | C00012833 |
|---|---|
| Name | 2-Hydroxyisocostic acid |
| CAS RN | 88153-64-4 |
| Standard InChI | InChI=1S/C15H22O3/c1-9-6-12(16)8-15(3)5-4-11(7-13(9)15)10(2)14(17)18/h6,11-13,16H,2,4-5,7-8H2,1,3H3,(H,17,18)/t11-,12+,13+,15+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H22O3/c1-9-6-12(16)8-15(3)5-4-11(7-13(9)15)10(2)14(17)18/h6,11-13,16H,2,4-5,7-8H2,1,3H3,(H,17,18) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 978 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Asteraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dittrichia viscosa | 56525 | Asteraceae | asterids | Viridiplantae |
| Schistostephium crataegifolium | 457732 | Asteraceae | asterids | Viridiplantae |