| id | C00012937 |
|---|---|
| Name | Atractylol / Atractylon / Atractyloxide / 4,4aalpha,5,6,7,8,8a,9-Octahydro-3,8alphabeta-dimethyl-5-methylenenaphtho[2,3-b]furan |
| CAS RN | 6989-21-5 |
| Standard InChI | InChI=1S/C15H20O/c1-10-5-4-6-15(3)8-14-12(7-13(10)15)11(2)9-16-14/h9,13H,1,4-8H2,2-3H3/t13-,15+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H20O/c1-10-5-4-6-15(3)8-14-12(7-13(10)15)11(2)9-16-14/h9,13H,1,4-8H2,2-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3874 |
| By standard InChI | CHEMBL486189 |
|---|---|
| By standard InChI Main Layer | CHEMBL486189 |
| By LinkDB | C16919 |
|---|
| By CAS RN | C046196 |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Asteraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Atractylis ovata | 69407 | Asteraceae | asterids | Viridiplantae |
| Atractylodes japonica | 41486 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P09917 | Arachidonate 5-lipoxygenase | Oxidoreductase | CHEMBL486189 |
CHEMBL1023322
(1)
|
0 / 0 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL486189 |
CHEMBL1023323
(1)
|
0 / 0 |