| id | C00012966 |
|---|---|
| Name | Ridentin B / (+)-Ridentin B |
| CAS RN | 41653-78-5 |
| Standard InChI | InChI=1S/C15H20O4/c1-7-9-4-5-15(3)11(17)6-10(16)8(2)12(15)13(9)19-14(7)18/h9-13,16-17H,1-2,4-6H2,3H3/t9-,10-,11+,12+,13-,15-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H20O4/c1-7-9-4-5-15(3)11(17)6-10(16)8(2)12(15)13(9)19-14(7)18/h9-13,16-17H,1-2,4-6H2,3H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 69 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL189854 CHEMBL362570 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artemisia tridentata | 55611 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL189854 CHEMBL362570 |
CHEMBL828644
(2)
CHEMBL861583
(2)
|
0 / 0 |
| Q00653 | Nuclear factor NF-kappa-B p100 subunit | Transcription Factor | CHEMBL189854 CHEMBL362570 |
CHEMBL828644
(2)
|
0 / 0 |
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL189854 CHEMBL362570 |
CHEMBL828644
(2)
|
0 / 0 |