| id | C00012973 |
|---|---|
| Name | Ludalbin / [3aR-(3aalpha,4alpha,5abeta,6alpha,9aalpha,9bbeta)]-4-(acetyloxy)-3a,4,5,5a,6,7,9a,9b-Octahydro-6-hydroxy-5a,9-dimethyl-3-methylenenaphtho[1,2-b]furan-2(3H)-one |
| CAS RN | 36437-90-8 |
| Standard InChI | InChI=1S/C17H22O5/c1-8-5-6-12(19)17(4)7-11(21-10(3)18)13-9(2)16(20)22-15(13)14(8)17/h5,11-15,19H,2,6-7H2,1,3-4H3/t11-,12-,13+,14+,15-,17-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H22O5/c1-8-5-6-12(19)17(4)7-11(21-10(3)18)13-9(2)16(20)22-15(13)14(8)17/h5,11-15,19H,2,6-7H2,1,3-4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 157 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 4 |
| family name | count |
|---|---|
| Asteraceae | 4 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Anthemis carpatica | 158218 | Asteraceae | asterids | Viridiplantae |
| Anthemis macedonica | 589761 | Asteraceae | asterids | Viridiplantae |
| Artemisia ludoviciana | 86312 | Asteraceae | asterids | Viridiplantae |
| Artemisia mexicana | 72346 | Asteraceae | asterids | Viridiplantae |