| id | C00001318 |
|---|---|
| Name | gamma-Nonalactone |
| CAS RN | 104-61-0 |
| Standard InChI | InChI=1S/C9H16O2/c1-2-3-4-5-8-6-7-9(10)11-8/h8H,2-7H2,1H3/t8-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C9H16O2/c1-2-3-4-5-8-6-7-9(10)11-8/h8H,2-7H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1374 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL191935 |
| By LinkDB | C08501 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Arecaceae | 1 |
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Brassica hirta | 3728 | Brassicaceae | rosids | Viridiplantae |
| Cocos nucifera | 13894 | Arecaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL191935 |
CHEMBL1794399
(1)
|
3 / 1 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL191935 |
CHEMBL830921
(1)
|
0 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL191935 |
CHEMBL2114890
(1)
|
0 / 0 |