| id | C00013266 |
|---|---|
| Name | Pneumatopterin A / 4'-Demethoxytriphyllin A / bis-(2S,4R)-3,4-dihydro-4-hydroxy-6-(hydroxymethyl)-8-methyl-2-phenyl-2H-1-benzopyran-5,7-diyl beta-D-Glucopyranoside |
| CAS RN | 192643-12-2 |
| Standard InChI | InChI=1S/C29H38O15/c1-11-25(43-28-23(38)21(36)19(34)16(9-31)41-28)13(8-30)27(44-29-24(39)22(37)20(35)17(10-32)42-29)18-14(33)7-15(40-26(11)18)12-5-3-2-4-6-12/h2-6,14-17,19-24,28-39H,7-10H2,1H3/t14-,15+,16?,17?,19-,20-,21+,22+,23?,24?,28+,29+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C29H38O15/c1-11-25(43-28-23(38)21(36)19(34)16(9-31)41-28)13(8-30)27(44-29-24(39)22(37)20(35)17(10-32)42-29)18-14(33)7-15(40-26(11)18)12-5-3-2-4-6-12/h2-6,14-17,19-24,28-39H,7-10H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 152 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1613027 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Euphyllophyta | 1 |
| family name | count |
|---|---|
| Thelypteridaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pneumatopteris pennigera | 173891 | Thelypteridaceae | Euphyllophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL1613027 |
CHEMBL1794311
(1)
|
2 / 3 |
| O75496 | Geminin | Unclassified protein | CHEMBL1613027 |
CHEMBL2114780
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1613027 |
CHEMBL1738588
(1)
|
0 / 0 |
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL1613027 |
CHEMBL1614364
(1)
|
1 / 1 |