| id | C00013298 |
|---|---|
| Name | 7-Hydroxy-3',4'-dimethoxyflavone / 2-(3,4-Dimethoxyphenyl)-7-hydroxy-4H-1-benzopyran-4-one |
| CAS RN | 33513-36-9 |
| Standard InChI | InChI=1S/C17H14O5/c1-20-14-6-3-10(7-17(14)21-2)15-9-13(19)12-5-4-11(18)8-16(12)22-15/h3-9,18H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O5/c1-20-14-6-3-10(7-17(14)21-2)15-9-13(19)12-5-4-11(18)8-16(12)22-15/h3-9,18H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL345778 |
|---|---|
| By standard InChI Main Layer | CHEMBL345778 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Launaea asplenifolia | 43198 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL345778 |
CHEMBL636747
(1)
CHEMBL643650
(1)
|
0 / 0 |