| id | C00013403 |
|---|---|
| Name | Licoflavone A / 7-Hydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| CAS RN | 61153-77-3 |
| Standard InChI | InChI=1S/C20H18O4/c1-12(2)3-4-14-9-16-18(23)11-19(24-20(16)10-17(14)22)13-5-7-15(21)8-6-13/h3,5-11,21-22H,4H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H18O4/c1-12(2)3-4-14-9-16-18(23)11-19(24-20(16)10-17(14)22)13-5-7-15(21)8-6-13/h3,5-11,21-22H,4H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 15 |
| By standard InChI | CHEMBL506929 |
|---|---|
| By standard InChI Main Layer | CHEMBL506929 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycyrrhiza eurycarpa | 372983 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL506929 |
CHEMBL1228967
(1)
|
0 / 0 |
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL506929 |
CHEMBL1068398
(1)
|
5 / 3 |