| id | C00013419 |
|---|---|
| Name | Gancaonin O / 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| CAS RN | 129145-53-5 |
| Standard InChI | InChI=1S/C20H18O6/c1-10(2)3-5-12-14(22)8-18-19(20(12)25)16(24)9-17(26-18)11-4-6-13(21)15(23)7-11/h3-4,6-9,21-23,25H,5H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H18O6/c1-10(2)3-5-12-14(22)8-18-19(20(12)25)16(24)9-17(26-18)11-4-6-13(21)15(23)7-11/h3-4,6-9,21-23,25H,5H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 15 |
| By standard InChI | CHEMBL1915459 |
|---|---|
| By standard InChI Main Layer | CHEMBL1915459 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Fabaceae | 1 |
| Hypericaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycyrrhiza uralensis | 74613 | Fabaceae | rosids | Viridiplantae |
| Hypericum perforatum | 65561 | Hypericaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P31749 | RAC-alpha serine/threonine-protein kinase | Akt | CHEMBL1915459 |
CHEMBL1918853
(1)
|
4 / 1 |