| id | C00013572 |
|---|---|
| Name | Torilenol / (1R,1aR,1bS,5R,5aR,6aR)-Decahydro-5a-methyl-2-methylene-1-(1-methylethyl)cycloprop[a]inden-5-ol |
| CAS RN | 84071-85-2 |
| Standard InChI | InChI=1S/C15H24O/c1-8(2)12-10-7-15(4)11(16)6-5-9(3)14(15)13(10)12/h8,10-14,16H,3,5-7H2,1-2,4H3/t10-,11-,12-,13?,14-,15+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H24O/c1-8(2)12-10-7-15(4)11(16)6-5-9(3)14(15)13(10)12/h8,10-14,16H,3,5-7H2,1-2,4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 333 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| asterids | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acorus calanus L. | 4464 | Acoraceae | Liliopsida | Viridiplantae |
| Torilis japonica | 49576 | Apiaceae | asterids | Viridiplantae |