| id | C00001373 |
|---|---|
| Name | L-Indospicine |
| CAS RN | 16377-00-7 |
| Standard InChI | InChI=1S/C7H15N3O2/c8-5(7(11)12)3-1-2-4-6(9)10/h5H,1-4,8H2,(H3,9,10)(H,11,12)/t5-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C7H15N3O2/c8-5(7(11)12)3-1-2-4-6(9)10/h5H,1-4,8H2,(H3,9,10)(H,11,12) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6804 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL369349 |
| By LinkDB | C08288 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Indigofera spicata | 520841 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35228 | Nitric oxide synthase, inducible | Enzyme | CHEMBL369349 |
CHEMBL839519
(1)
|
1 / 1 |