| id | C00013835 |
|---|---|
| Name | Quercetin 4'-galactoside |
| CAS RN | 381728-34-3 |
| Standard InChI | InChI=1S/C21H20O12/c22-6-13-15(26)17(28)19(30)21(33-13)32-11-2-1-7(3-9(11)24)20-18(29)16(27)14-10(25)4-8(23)5-12(14)31-20/h1-5,13,15,17,19,21-26,28-30H,6H2/t13-,15+,17?,19?,21-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H20O12/c22-6-13-15(26)17(28)19(30)21(33-13)32-11-2-1-7(3-9(11)24)20-18(29)16(27)14-10(25)4-8(23)5-12(14)31-20/h1-5,13,15,17,19,21-26,28-30H,6H2 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL402947 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Amaranthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cornulaca monacantha | 454476 | Amaranthaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL402947 |
CHEMBL1614175
(1)
|
1 / 1 |
| P15121 | Aldose reductase | Enzyme | CHEMBL402947 |
CHEMBL1942674
(1)
|
0 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL402947 |
CHEMBL1614211
(1)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL402947 |
CHEMBL1614257
(1)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL402947 |
CHEMBL1614257
(1)
|
1 / 3 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #232300 | Glycogen storage disease ii |
P10253
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00069 | Glycogen storage diseases (GSD) |
P10253
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|