| id | C00014142 |
|---|---|
| Name | 5,7,4'-Trihydroxy-3'-methoxyflavanone 4'-O-isobutyrate |
| CAS RN | 140163-21-9 |
| Standard InChI | InChI=1S/C20H20O7/c1-10(2)20(24)27-15-5-4-11(6-17(15)25-3)16-9-14(23)19-13(22)7-12(21)8-18(19)26-16/h4-8,10,16,21-22H,9H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O7/c1-10(2)20(24)27-15-5-4-11(6-17(15)25-3)16-9-14(23)19-13(22)7-12(21)8-18(19)26-16/h4-8,10,16,21-22H,9H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8099 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL490162 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Hydrophyllaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eriodictyon californicum | 4132 | Hydrophyllaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P59538 | Taste receptor type 2 member 31 | Taste receptor (taste family GPCR) | CHEMBL490162 |
CHEMBL2039382
(1)
|
0 / 0 |