| id | C00014631 |
|---|---|
| Name | 4-Methoxyphlorizin / 2',4',6'-Trihydroxy-4-methoxydihydrochalcone 2'-O-glucoside |
| CAS RN | 4369-35-1 |
| Standard InChI | InChI=1S/C22H26O10/c1-30-13-5-2-11(3-6-13)4-7-14(25)18-15(26)8-12(24)9-16(18)31-22-21(29)20(28)19(27)17(10-23)32-22/h2-3,5-6,8-9,17,19-24,26-29H,4,7,10H2,1H3/t17?,19-,20+,21?,22-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H26O10/c1-30-13-5-2-11(3-6-13)4-7-14(25)18-15(26)8-12(24)9-16(18)31-22-21(29)20(28)19(27)17(10-23)32-22/h2-3,5-6,8-9,17,19-24,26-29H,4,7,10H2,1H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 36 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL2303988 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Myristicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Iryanthera sagotiana | 597310 | Myristicaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL2303988 |
CHEMBL809058
(1)
|
1 / 1 |