| id | C00015085 |
|---|---|
| Name | Endophenazine A |
| CAS RN | 86125-71-5 |
| Standard InChI | InChI=1S/C18H16N2O2/c1-11(2)9-10-12-5-3-7-14-16(12)20-17-13(18(21)22)6-4-8-15(17)19-14/h3-9H,10H2,1-2H3,(H,21,22) |
| Standard InChI (Main Layer) | InChI=1S/C18H16N2O2/c1-11(2)9-10-12-5-3-7-14-16(12)20-17-13(18(21)22)6-4-8-15(17)19-14/h3-9H,10H2,1-2H3,(H,21,22) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3884 |
| By standard InChI | CHEMBL2071428 |
|---|---|
| By standard InChI Main Layer | CHEMBL2071428 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces anulatus 9663 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL2071428 |
CHEMBL2072352
(1)
|
1 / 0 |