| id | C00015086 |
|---|---|
| Name | Endophenazine B |
| CAS RN | 479415-40-2 |
| Standard InChI | InChI=1S/C19H18N2O3/c1-11(2)7-8-12-9-13(22)10-16-17(12)20-18-14(19(23)24)5-4-6-15(18)21(16)3/h4-7,9-10H,8H2,1-3H3,(H,23,24) |
| Standard InChI (Main Layer) | InChI=1S/C19H18N2O3/c1-11(2)7-8-12-9-13(22)10-16-17(12)20-18-14(19(23)24)5-4-6-15(18)21(16)3/h4-7,9-10H,8H2,1-3H3,(H,23,24) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3884 |
| By standard InChI | CHEMBL1952289 |
|---|---|
| By standard InChI Main Layer | CHEMBL1952289 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces anulatus 9663 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL1952289 |
CHEMBL2072352
(1)
|
1 / 0 |