| id | C00015191 |
|---|---|
| Name | 1,7-Dihydroxy-2,5-dimethoxy-9,10-dihydrophenanthrene |
| CAS RN | 118201-22-2 |
| Standard InChI | InChI=1S/C16H16O4/c1-19-13-6-5-11-12(16(13)18)4-3-9-7-10(17)8-14(20-2)15(9)11/h5-8,17-18H,3-4H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H16O4/c1-19-13-6-5-11-12(16(13)18)4-3-9-7-10(17)8-14(20-2)15(9)11/h5-8,17-18H,3-4H2,1-2H3 |
| Phytochemical cluster | No. 28 |
|---|---|
| KCF-S cluster | No. 75 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 2 |
| family name | count |
|---|---|
| Orchidaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Epipactis palustris | 210730 | Orchidaceae | Liliopsida | Viridiplantae |
| Eulophia nuda | 78774 | Orchidaceae | Liliopsida | Viridiplantae |