id | C00015279 |
---|---|
Name | Dihydropiceatannol / 3,3',4,5'-Tetrahydroxybibenzyl |
CAS RN | 22318-80-5 |
Standard InChI | InChI=1S/C14H14O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h3-8,15-18H,1-2H2 |
Standard InChI (Main Layer) | InChI=1S/C14H14O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h3-8,15-18H,1-2H2 |
Phytochemical cluster | No. 26 |
---|---|
KCF-S cluster | No. 242 |
By standard InChI | CHEMBL329520 |
---|---|
By standard InChI Main Layer | CHEMBL329520 |
By LinkDB |
---|
By CAS RN | C074505 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Cassia garrettiana | 53851 | Fabaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL329520 |
CHEMBL765997
(1)
|
0 / 1 |