id | C00015301 |
---|---|
Name | 3,4,5'-Trimethoxystilbene |
CAS RN | 70709-66-9 |
Standard InChI | InChI=1S/C14H12O3/c15-12-3-1-2-10(8-12)4-5-11-6-7-13(16)14(17)9-11/h1-9,15-17H/b5-4+ |
Standard InChI (Main Layer) | InChI=1S/C14H12O3/c15-12-3-1-2-10(8-12)4-5-11-6-7-13(16)14(17)9-11/h1-9,15-17H |
Phytochemical cluster | No. 13 |
---|---|
KCF-S cluster | No. 295 |
By standard InChI | CHEMBL103464 |
---|---|
By standard InChI Main Layer | CHEMBL103464 |
By LinkDB |
---|
By CAS RN | C094055 |
---|
class name | count |
---|---|
Magnoliophyta | 1 |
family name | count |
---|---|
Myristicaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Virola cuspidata | 224865 | Myristicaceae | Magnoliophyta | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL103464 |
CHEMBL765997
(1)
|
0 / 1 |