| id | C00015369 |
|---|---|
| Name | F 10463a / Scyphostatin / (+)-Scyphostatin |
| CAS RN | 169062-93-5 |
| Standard InChI | InChI=1S/C29H43NO5/c1-6-20(2)15-22(4)17-23(5)16-21(3)11-9-7-8-10-12-27(33)30-24(19-31)18-29(34)26(32)14-13-25-28(29)35-25/h7-15,20-21,23-25,28,31,34H,6,16-19H2,1-5H3,(H,30,33)/b8-7+,11-9+,12-10+,22-15+/t20-,21+,23+,24+,25+,28+,29-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C29H43NO5/c1-6-20(2)15-22(4)17-23(5)16-21(3)11-9-7-8-10-12-27(33)30-24(19-31)18-29(34)26(32)14-13-25-28(29)35-25/h7-15,20-21,23-25,28,31,34H,6,16-19H2,1-5H3,(H,30,33) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5986 |
| By standard InChI | CHEMBL418376 |
|---|---|
| By standard InChI Main Layer | CHEMBL418376 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Hyaloscyphaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Trichopeziza mollissima SANK 13892 | 47815 | Hyaloscyphaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O60906 | Sphingomyelin phosphodiesterase 2 | Enzyme | CHEMBL418376 |
CHEMBL751441
(1)
|
0 / 0 |