| id | C00015395 |
|---|---|
| Name | 3,5-Dihydroxy-4'-methoxystilbene 3-O-beta-D-glucopyranoside |
| CAS RN | 65830-63-9 |
| Standard InChI | InChI=1S/C21H24O8/c1-27-15-6-4-12(5-7-15)2-3-13-8-14(23)10-16(9-13)28-21-20(26)19(25)18(24)17(11-22)29-21/h2-10,17-26H,11H2,1H3/b3-2+/t17?,18-,19+,20?,21-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H24O8/c1-27-15-6-4-12(5-7-15)2-3-13-8-14(23)10-16(9-13)28-21-20(26)19(25)18(24)17(11-22)29-21/h2-10,17-26H,11H2,1H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 36 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL113536 CHEMBL464004 CHEMBL1513359 CHEMBL1863546 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Polygonaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Rheum rhaponticum | 46087 | Polygonaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL1863546 |
CHEMBL2114780
(1)
|
0 / 0 |
| P38398 | Breast cancer type 1 susceptibility protein | Enzyme | CHEMBL1863546 |
CHEMBL2114807
(1)
|
4 / 2 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1863546 |
CHEMBL2114788
(1)
|
0 / 0 |