| id | C00015408 |
|---|---|
| Name | F 11334A3 |
| CAS RN | 171812-81-0 |
| Standard InChI | InChI=1S/C11H14O3/c1-11(2)10(13)6-7-5-8(12)3-4-9(7)14-11/h3-5,10,12-13H,6H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C11H14O3/c1-11(2)10(13)6-7-5-8(12)3-4-9(7)14-11/h3-5,10,12-13H,6H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3947 |
| By standard InChI | CHEMBL454034 |
|---|---|
| By standard InChI Main Layer | CHEMBL454034 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Hypocreaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acremonium murorum (Corda)W.Gams SANK 20793 | 5129 | Hypocreaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL454034 |
CHEMBL1004742
(1)
|
0 / 1 |