| id | C00015484 |
|---|---|
| Name | UCK 14A / UCK 14A1 / Belactosin A |
| CAS RN | 189871-53-2 |
| Standard InChI | InChI=1S/C17H27N3O6/c1-4-7(2)12-13(26-17(12)25)15(22)19-10-5-9(10)6-11(16(23)24)20-14(21)8(3)18/h7-13H,4-6,18H2,1-3H3,(H,19,22)(H,20,21)(H,23,24)/t7-,8-,9+,10-,11-,12-,13+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H27N3O6/c1-4-7(2)12-13(26-17(12)25)15(22)19-10-5-9(10)6-11(16(23)24)20-14(21)8(3)18/h7-13H,4-6,18H2,1-3H3,(H,19,22)(H,20,21)(H,23,24) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7226 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL491636 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. KY11780 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P28062 | Proteasome subunit beta type-8 | T1A | CHEMBL491636 |
CHEMBL2343623
(1)
|
1 / 0 |
| P28074 | Proteasome subunit beta type-5 | T1A | CHEMBL491636 |
CHEMBL2343625
(1)
CHEMBL2343628
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #256040 | Autoinflammation, lipodystrophy, and dermatosis syndrome; aldd |
P28062
|